C27H40O8 — CID 54676751
methyl (4aR,4bR,7R,8R,8aR,10aS)-7-(2,2-dimethylpropanoyloxymethyl)-2-hydroxy-8-(methoxymethoxy)-1,1,4a-trimethyl-5-oxo-4b,6,7,8,8a,10a-hexahydro-4H-phenanthrene-3-carboxylate (PubChem CID 54676751) has the molecular formula C27H40O8 and a molecular weight of 492.61 g/mol. Its IUPAC name is methyl (4aR,4bR,7R,8R,8aR,10aS)-7-(2,2-dimethylpropanoyloxymethyl)-2-hydroxy-8-(methoxymethoxy)-1,1,4a-trimethyl-5-oxo-4b,6,7,8,8a,10a-hexahydro-4H-phenanthrene-3-carboxylate.
| Compound Name | methyl (4aR,4bR,7R,8R,8aR,10aS)-7-(2,2-dimethylpropanoyloxymethyl)-2-hydroxy-8-(methoxymethoxy)-1,1,4a-trimethyl-5-oxo-4b,6,7,8,8a,10a-hexahydro-4H-phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 54676751 |
| Molecular Formula | C27H40O8 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | methyl (4aR,4bR,7R,8R,8aR,10aS)-7-(2,2-dimethylpropanoyloxymethyl)-2-hydroxy-8-(methoxymethoxy)-1,1,4a-trimethyl-5-oxo-4b,6,7,8,8a,10a-hexahydro-4H-phenanthrene-3-carboxylate |
| SMILES | COCO[C@H]1[C@@H](COC(=O)C(C)(C)C)CC(=O)[C@@H]2[C@H]1C=C[C@@H]1C(C)(C)C(O)=C(C(=O)OC)C[C@@]21C |
| InChI | InChI=1S/C27H40O8/c1-25(2,3)24(31)34-13-15-11-18(28)20-16(21(15)35-14-32-7)9-10-19-26(4,5)22(29)17(23(30)33-8)12-27(19,20)6/h9-10,15-16,19-21,29H,11-14H2,1-8H3/t15-,16-,19-,20+,21+,27-/m1/s1 |
| InChIKey | PJVIBBLCQBHFCR-BXTHLUAISA-N |
| XLogP | 3.99 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|