C27H21N3O4 — CID 54677451
6-benzyl-5-hydroxy-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 54677451) has the molecular formula C27H21N3O4 and a molecular weight of 451.48 g/mol. Its IUPAC name is 6-benzyl-5-hydroxy-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 6-benzyl-5-hydroxy-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 54677451 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 6-benzyl-5-hydroxy-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1c(=O)c(Cc2ccccc2)c(O)c2c(=O)n(-c3ccccc3)c(=O)n(-c3ccccc3)c21 |
| InChI | InChI=1S/C27H21N3O4/c1-28-24-22(23(31)21(25(28)32)17-18-11-5-2-6-12-18)26(33)30(20-15-9-4-10-16-20)27(34)29(24)19-13-7-3-8-14-19/h2-16,31H,17H2,1H3 |
| InChIKey | LWXANQCDFKZVLY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |