C40H68O2 — CID 5467750
2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methyl-1-propan-2-ylidenecyclohexane;1-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-2-yl]-4-methylcyclohexene (PubChem CID 5467750) has the molecular formula C40H68O2 and a molecular weight of 580.98 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methyl-1-propan-2-ylidenecyclohexane;1-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-2-yl]-4-methylcyclohexene.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methyl-1-propan-2-ylidenecyclohexane;1-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-2-yl]-4-methylcyclohexene |
|---|---|
| PubChem CID | 5467750 |
| Molecular Formula | C40H68O2 |
| Molecular Weight | 580.98 g/mol |
| Exact Mass | 580.52 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methyl-1-propan-2-ylidenecyclohexane;1-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-2-yl]-4-methylcyclohexene |
| SMILES | CC(C)=CCC/C(C)=C/COC(C)(C)C1=CCC(C)CC1.CC(C)=CCC/C(C)=C/COC1CC(C)CCC1=C(C)C |
| InChI | InChI=1S/2C20H34O/c1-16(2)8-7-9-17(3)14-15-21-20(5,6)19-12-10-18(4)11-13-19;1-15(2)8-7-9-17(5)12-13-21-20-14-18(6)10-11-19(20)16(3)4/h8,12,14,18H,7,9-11,13,15H2,1-6H3;8,12,18,20H,7,9-11,13-14H2,1-6H3/b17-14+;17-12+ |
| InChIKey | AIKDUJTUBBMUDW-OYGNFUGKSA-N |
| XLogP | 12.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.98 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|