About N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide
N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide (PubChem CID 54677517) has the molecular formula C19H24N4O4
and a molecular weight of 372.43 g/mol. Its IUPAC name is N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide |
| PubChem CID | 54677517 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1nc(C2COCCN2C)n(C)c(=O)c1O |
| InChI | InChI=1S/C19H24N4O4/c1-21-9-10-27-12-14(21)17-20-15(16(24)19(26)23(17)3)18(25)22(2)11-13-7-5-4-6-8-13/h4-8,14,24H,9-12H2,1-3H3 |
| InChIKey | RDXYSUUPAUIXNP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide?
The IUPAC name of N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide (CID 54677517) is N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide.
What is the SMILES notation for N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide?
The canonical SMILES for N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide is CN(Cc1ccccc1)C(=O)c1nc(C2COCCN2C)n(C)c(=O)c1O.
What is the InChIKey of N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide?
The InChIKey is RDXYSUUPAUIXNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O4/c1-21-9-10-27-12-14(21)17-20-15(16(24)19(26)23(17)3)18(25)22(2)11-13-7-5-4-6-8-13/h4-8,14,24H,9-12H2,1-3H3.
What are the key properties of N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide?
N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide has a molecular weight of 372.43 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-hydroxy-N,1-dimethyl-2-(4-methylmorpholin-3-yl)-6-oxopyrimidine-4-carboxamide is sourced from PubChem (CID 54677517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).