C24H20O8 — CID 54678090
2,2-bis(8-ethyl-4-hydroxy-2-oxochromen-3-yl)acetic acid (PubChem CID 54678090) has the molecular formula C24H20O8 and a molecular weight of 436.42 g/mol. Its IUPAC name is 2,2-bis(8-ethyl-4-hydroxy-2-oxochromen-3-yl)acetic acid.
| Compound Name | 2,2-bis(8-ethyl-4-hydroxy-2-oxochromen-3-yl)acetic acid |
|---|---|
| PubChem CID | 54678090 |
| Molecular Formula | C24H20O8 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2,2-bis(8-ethyl-4-hydroxy-2-oxochromen-3-yl)acetic acid |
| SMILES | CCc1cccc2c(O)c(C(C(=O)O)c3c(O)c4cccc(CC)c4oc3=O)c(=O)oc12 |
| InChI | InChI=1S/C24H20O8/c1-3-11-7-5-9-13-18(25)16(23(29)31-20(11)13)15(22(27)28)17-19(26)14-10-6-8-12(4-2)21(14)32-24(17)30/h5-10,15,25-26H,3-4H2,1-2H3,(H,27,28) |
| InChIKey | YQFZOPNBKKIGJM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|