About Coumatetralyl
Coumatetralyl (PubChem CID 54678504) has the molecular formula C19H16O3
and a molecular weight of 292.30 g/mol. Its IUPAC name is 4-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-1-yl)chromen-2-one.
Molecular Properties
| Compound Name | Coumatetralyl |
| PubChem CID | 54678504 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-1-yl)chromen-2-one |
| SMILES | C1CC(C2=CC=CC=C2C1)C3=C(C4=CC=CC=C4OC3=O)O |
| InChI | InChI=1S/C19H16O3/c20-18-15-9-3-4-11-16(15)22-19(21)17(18)14-10-5-7-12-6-1-2-8-13(12)14/h1-4,6,8-9,11,14,20H,5,7,10H2 |
| InChIKey | ULSLJYXHZDTLQK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | 481 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze Coumatetralyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Coumatetralyl?
The IUPAC name of Coumatetralyl (CID 54678504) is 4-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-1-yl)chromen-2-one.
What is the SMILES notation for Coumatetralyl?
The canonical SMILES for Coumatetralyl is C1CC(C2=CC=CC=C2C1)C3=C(C4=CC=CC=C4OC3=O)O.
What is the InChIKey of Coumatetralyl?
The InChIKey is ULSLJYXHZDTLQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O3/c20-18-15-9-3-4-11-16(15)22-19(21)17(18)14-10-5-7-12-6-1-2-8-13(12)14/h1-4,6,8-9,11,14,20H,5,7,10H2.
What are the key properties of Coumatetralyl?
Coumatetralyl has a molecular weight of 292.30 g/mol, XLogP of 4.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Coumatetralyl is sourced from PubChem (CID 54678504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).