C15H20O5 — CID 54678512
methyl (1S,2R,5R,6R,7R)-3-hydroxy-5-(methoxymethoxymethyl)tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate (PubChem CID 54678512) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl (1S,2R,5R,6R,7R)-3-hydroxy-5-(methoxymethoxymethyl)tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate.
| Compound Name | methyl (1S,2R,5R,6R,7R)-3-hydroxy-5-(methoxymethoxymethyl)tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
|---|---|
| PubChem CID | 54678512 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | methyl (1S,2R,5R,6R,7R)-3-hydroxy-5-(methoxymethoxymethyl)tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
| SMILES | COCOC[C@H]1C(C(=O)OC)=C(O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C15H20O5/c1-18-7-20-6-10-11-8-3-4-9(5-8)12(11)14(16)13(10)15(17)19-2/h3-4,8-12,16H,5-7H2,1-2H3/t8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | AHXFHHMPQCSNLY-VSSNEEPJSA-N |
| XLogP | 1.66 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|