C10H17Br3 — CID 5467862
(E)-1,6,7-tribromo-3,7-dimethyloct-2-ene (PubChem CID 5467862) has the molecular formula C10H17Br3 and a molecular weight of 376.96 g/mol. Its IUPAC name is (E)-1,6,7-tribromo-3,7-dimethyloct-2-ene.
| Compound Name | (E)-1,6,7-tribromo-3,7-dimethyloct-2-ene |
|---|---|
| PubChem CID | 5467862 |
| Molecular Formula | C10H17Br3 |
| Molecular Weight | 376.96 g/mol |
| Exact Mass | 373.89 |
| IUPAC Name | (E)-1,6,7-tribromo-3,7-dimethyloct-2-ene |
| SMILES | C/C(=C\CBr)CCC(Br)C(C)(C)Br |
| InChI | InChI=1S/C10H17Br3/c1-8(6-7-11)4-5-9(12)10(2,3)13/h6,9H,4-5,7H2,1-3H3/b8-6+ |
| InChIKey | PXKOESLWITWTLF-SOFGYWHQSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.96 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|