4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid

C8H9NO4 — CID 54678654

IUPAC4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid
SMILESCc1cc(O)c(C(=O)O)c(=O)n1C
InChIInChI=1S/C8H9NO4/c1-4-3-5(10)6(8(12)13)7(11)9(4)2/h3,10H,1-2H3,(H,12,13)
InChIKeyYCKHQBWJENFMAH-UHFFFAOYSA-N
MW183.16 g/mol
LogP0.10
Rot. Bonds1

About 4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid

4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid (PubChem CID 54678654) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid.

Molecular Properties

Compound Name4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid
PubChem CID54678654
Molecular FormulaC8H9NO4
Molecular Weight183.16 g/mol
Exact Mass183.05
IUPAC Name4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid
SMILESCc1cc(O)c(C(=O)O)c(=O)n1C
InChIInChI=1S/C8H9NO4/c1-4-3-5(10)6(8(12)13)7(11)9(4)2/h3,10H,1-2H3,(H,12,13)
InChIKeyYCKHQBWJENFMAH-UHFFFAOYSA-N
XLogP0.10
TPSA79.53 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.16
LogP ≤ 50.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid?
The IUPAC name of 4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid (CID 54678654) is 4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid.
What is the SMILES notation for 4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid?
The canonical SMILES for 4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid is Cc1cc(O)c(C(=O)O)c(=O)n1C.
What is the InChIKey of 4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid?
The InChIKey is YCKHQBWJENFMAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4/c1-4-3-5(10)6(8(12)13)7(11)9(4)2/h3,10H,1-2H3,(H,12,13).
What are the key properties of 4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid?
4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid has a molecular weight of 183.16 g/mol, XLogP of 0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,6-dimethyl-2-oxopyridine-3-carboxylic acid is sourced from PubChem (CID 54678654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).