C17H19NO6 — CID 54678867
(3Z)-1-cyclopropyl-3-[hydroxy-(3,4,5-trimethoxyphenyl)methylidene]pyrrolidine-2,4-dione (PubChem CID 54678867) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is (3Z)-1-cyclopropyl-3-[hydroxy-(3,4,5-trimethoxyphenyl)methylidene]pyrrolidine-2,4-dione.
| Compound Name | (3Z)-1-cyclopropyl-3-[hydroxy-(3,4,5-trimethoxyphenyl)methylidene]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 54678867 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (3Z)-1-cyclopropyl-3-[hydroxy-(3,4,5-trimethoxyphenyl)methylidene]pyrrolidine-2,4-dione |
| SMILES | COc1cc(/C(O)=C2\C(=O)CN(C3CC3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C17H19NO6/c1-22-12-6-9(7-13(23-2)16(12)24-3)15(20)14-11(19)8-18(17(14)21)10-4-5-10/h6-7,10,20H,4-5,8H2,1-3H3/b15-14- |
| InChIKey | NVNZALFUBBPNCQ-PFONDFGASA-N |
| XLogP | 1.56 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|