About 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one
2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one (PubChem CID 54679007) has the molecular formula C13H7Cl2NO3S
and a molecular weight of 328.18 g/mol. Its IUPAC name is 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one.
Molecular Properties
| Compound Name | 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one |
| PubChem CID | 54679007 |
| Molecular Formula | C13H7Cl2NO3S |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one |
| SMILES | O=c1[nH]c2sc(Cl)c(-c3ccc(O)cc3)c2c(O)c1Cl |
| InChI | InChI=1S/C13H7Cl2NO3S/c14-9-10(18)8-7(5-1-3-6(17)4-2-5)11(15)20-13(8)16-12(9)19/h1-4,17H,(H2,16,18,19) |
| InChIKey | BVJIPFDIOHGQPP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
The IUPAC name of 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one (CID 54679007) is 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one.
What is the SMILES notation for 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
The canonical SMILES for 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one is O=c1[nH]c2sc(Cl)c(-c3ccc(O)cc3)c2c(O)c1Cl.
What is the InChIKey of 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
The InChIKey is BVJIPFDIOHGQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl2NO3S/c14-9-10(18)8-7(5-1-3-6(17)4-2-5)11(15)20-13(8)16-12(9)19/h1-4,17H,(H2,16,18,19).
What are the key properties of 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one has a molecular weight of 328.18 g/mol, XLogP of 3.97, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-4-hydroxy-3-(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one is sourced from PubChem (CID 54679007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).