C17H19F3O3S — CID 54679010
ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]hex-2-enoate (PubChem CID 54679010) has the molecular formula C17H19F3O3S and a molecular weight of 360.40 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]hex-2-enoate.
| Compound Name | ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]hex-2-enoate |
|---|---|
| PubChem CID | 54679010 |
| Molecular Formula | C17H19F3O3S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]hex-2-enoate |
| SMILES | CCC/C(O)=C(C(=O)OCC)/C(=C\Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H19F3O3S/c1-3-8-14(21)15(16(22)23-4-2)13(17(18,19)20)11-24-12-9-6-5-7-10-12/h5-7,9-11,21H,3-4,8H2,1-2H3/b13-11+,15-14+ |
| InChIKey | AZRSCPWJRLYDTH-VVOKNZMXSA-N |
| XLogP | 5.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|