C26H17Cl3N2O5 — CID 54679260
ethyl 4-[5-(1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazole-5-carboxylate (PubChem CID 54679260) has the molecular formula C26H17Cl3N2O5 and a molecular weight of 543.79 g/mol. Its IUPAC name is ethyl 4-[5-(1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 4-[5-(1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 54679260 |
| Molecular Formula | C26H17Cl3N2O5 |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | ethyl 4-[5-(1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]n(-c2c(Cl)cc(Cl)cc2Cl)c(=O)c1C=CC=CC=C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H17Cl3N2O5/c1-2-36-26(35)21-17(25(34)31(30-21)22-19(28)12-14(27)13-20(22)29)10-4-3-5-11-18-23(32)15-8-6-7-9-16(15)24(18)33/h3-13,30H,2H2,1H3 |
| InChIKey | PDVLGESBJVLHRJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|