About ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate
ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate (PubChem CID 54679329) has the molecular formula C16H15NO4
and a molecular weight of 285.30 g/mol. Its IUPAC name is ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate |
| PubChem CID | 54679329 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1c(O)c2c([nH]c1=O)CCc1ccccc1-2 |
| InChI | InChI=1S/C16H15NO4/c1-2-21-16(20)13-14(18)12-10-6-4-3-5-9(10)7-8-11(12)17-15(13)19/h3-6H,2,7-8H2,1H3,(H2,17,18,19) |
| InChIKey | IHVYGBUBDPSHQR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate?
The IUPAC name of ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate (CID 54679329) is ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate.
What is the SMILES notation for ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate?
The canonical SMILES for ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate is CCOC(=O)c1c(O)c2c([nH]c1=O)CCc1ccccc1-2.
What is the InChIKey of ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate?
The InChIKey is IHVYGBUBDPSHQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4/c1-2-21-16(20)13-14(18)12-10-6-4-3-5-9(10)7-8-11(12)17-15(13)19/h3-6H,2,7-8H2,1H3,(H2,17,18,19).
What are the key properties of ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate?
ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate has a molecular weight of 285.30 g/mol, XLogP of 2.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-hydroxy-3-oxo-5,6-dihydro-4H-benzo[f]quinoline-2-carboxylate is sourced from PubChem (CID 54679329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).