C21H17ClN2O4 — CID 54679379
ethyl (2Z,4Z)-4-benzamido-5-(2-chlorophenyl)-2-cyano-3-hydroxypenta-2,4-dienoate (PubChem CID 54679379) has the molecular formula C21H17ClN2O4 and a molecular weight of 396.83 g/mol. Its IUPAC name is ethyl (2Z,4Z)-4-benzamido-5-(2-chlorophenyl)-2-cyano-3-hydroxypenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4Z)-4-benzamido-5-(2-chlorophenyl)-2-cyano-3-hydroxypenta-2,4-dienoate |
|---|---|
| PubChem CID | 54679379 |
| Molecular Formula | C21H17ClN2O4 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | ethyl (2Z,4Z)-4-benzamido-5-(2-chlorophenyl)-2-cyano-3-hydroxypenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C#N)=C(O)/C(=C/c1ccccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17ClN2O4/c1-2-28-21(27)16(13-23)19(25)18(12-15-10-6-7-11-17(15)22)24-20(26)14-8-4-3-5-9-14/h3-12,25H,2H2,1H3,(H,24,26)/b18-12-,19-16- |
| InChIKey | CACCUOTYGLYOLP-VZZSTEPBSA-N |
| XLogP | 4.01 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|