About 4,7-dihydroxychromen-2-one
4,7-dihydroxychromen-2-one (PubChem CID 54679630) has the molecular formula C9H6O4
and a molecular weight of 178.14 g/mol. Its IUPAC name is 4,7-dihydroxychromen-2-one.
Molecular Properties
| Compound Name | 4,7-dihydroxychromen-2-one |
| PubChem CID | 54679630 |
| Molecular Formula | C9H6O4 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 4,7-dihydroxychromen-2-one |
| SMILES | O=c1cc(O)c2ccc(O)cc2o1 |
| InChI | InChI=1S/C9H6O4/c10-5-1-2-6-7(11)4-9(12)13-8(6)3-5/h1-4,10-11H |
| InChIKey | CYSRKZFPSNZSCS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dihydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydroxychromen-2-one?
The IUPAC name of 4,7-dihydroxychromen-2-one (CID 54679630) is 4,7-dihydroxychromen-2-one.
What is the SMILES notation for 4,7-dihydroxychromen-2-one?
The canonical SMILES for 4,7-dihydroxychromen-2-one is O=c1cc(O)c2ccc(O)cc2o1.
What is the InChIKey of 4,7-dihydroxychromen-2-one?
The InChIKey is CYSRKZFPSNZSCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O4/c10-5-1-2-6-7(11)4-9(12)13-8(6)3-5/h1-4,10-11H.
What are the key properties of 4,7-dihydroxychromen-2-one?
4,7-dihydroxychromen-2-one has a molecular weight of 178.14 g/mol, XLogP of 1.20, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydroxychromen-2-one is sourced from PubChem (CID 54679630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).