About methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate
methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate (PubChem CID 54679639) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate |
| PubChem CID | 54679639 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate |
| SMILES | COC(=O)C1=C/C(=C(\C)O)C(C(C)=O)=C1C |
| InChI | InChI=1S/C12H14O4/c1-6-9(12(15)16-4)5-10(7(2)13)11(6)8(3)14/h5,13H,1-4H3/b10-7- |
| InChIKey | NCKMMAKCBOBCAS-YFHOEESVSA-N |
| XLogP | 1.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate?
The IUPAC name of methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate (CID 54679639) is methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate.
What is the SMILES notation for methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate?
The canonical SMILES for methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate is COC(=O)C1=C/C(=C(\C)O)C(C(C)=O)=C1C.
What is the InChIKey of methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate?
The InChIKey is NCKMMAKCBOBCAS-YFHOEESVSA-N. The full InChI is InChI=1S/C12H14O4/c1-6-9(12(15)16-4)5-10(7(2)13)11(6)8(3)14/h5,13H,1-4H3/b10-7-.
What are the key properties of methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate?
methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate has a molecular weight of 222.24 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3Z)-4-acetyl-3-(1-hydroxyethylidene)-5-methylcyclopenta-1,4-diene-1-carboxylate is sourced from PubChem (CID 54679639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).