C13H18O6 — CID 54679881
methyl (3aR,4aR,8aR,8bR)-7-hydroxy-2,2-dimethyl-3a,4a,5,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-b][1]benzofuran-6-carboxylate (PubChem CID 54679881) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl (3aR,4aR,8aR,8bR)-7-hydroxy-2,2-dimethyl-3a,4a,5,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-b][1]benzofuran-6-carboxylate.
| Compound Name | methyl (3aR,4aR,8aR,8bR)-7-hydroxy-2,2-dimethyl-3a,4a,5,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-b][1]benzofuran-6-carboxylate |
|---|---|
| PubChem CID | 54679881 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | methyl (3aR,4aR,8aR,8bR)-7-hydroxy-2,2-dimethyl-3a,4a,5,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-b][1]benzofuran-6-carboxylate |
| SMILES | COC(=O)C1=C(O)C[C@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]2C1 |
| InChI | InChI=1S/C13H18O6/c1-13(2)18-10-7-4-8(14)6(11(15)16-3)5-9(7)17-12(10)19-13/h7,9-10,12,14H,4-5H2,1-3H3/t7-,9-,10-,12-/m1/s1 |
| InChIKey | VLKYZCFFYXDVDB-UGKPPGOTSA-N |
| XLogP | 1.26 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |