C22H22N2O2S2 — CID 54679921
6-tert-butyl-15-hydroxy-9-thiophen-2-yl-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one (PubChem CID 54679921) has the molecular formula C22H22N2O2S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 6-tert-butyl-15-hydroxy-9-thiophen-2-yl-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one.
| Compound Name | 6-tert-butyl-15-hydroxy-9-thiophen-2-yl-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one |
|---|---|
| PubChem CID | 54679921 |
| Molecular Formula | C22H22N2O2S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 6-tert-butyl-15-hydroxy-9-thiophen-2-yl-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one |
| SMILES | CC(C)(C)C1CCc2nc3sc4c(O)cc(=O)[nH]c4c3c(-c3cccs3)c2C1 |
| InChI | InChI=1S/C22H22N2O2S2/c1-22(2,3)11-6-7-13-12(9-11)17(15-5-4-8-27-15)18-19-20(28-21(18)23-13)14(25)10-16(26)24-19/h4-5,8,10-11H,6-7,9H2,1-3H3,(H2,24,25,26) |
| InChIKey | QOULOHIXBFQYGE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |