C18H12IN2O4S- — CID 54680128
4-[(Z)-[2-(4-carboxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenolate (PubChem CID 54680128) has the molecular formula C18H12IN2O4S- and a molecular weight of 479.28 g/mol. Its IUPAC name is 4-[(Z)-[2-(4-carboxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenolate.
| Compound Name | 4-[(Z)-[2-(4-carboxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenolate |
|---|---|
| PubChem CID | 54680128 |
| Molecular Formula | C18H12IN2O4S- |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 478.96 |
| IUPAC Name | 4-[(Z)-[2-(4-carboxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenolate |
| SMILES | CN1C(=O)/C(=C/c2ccc([O-])c(I)c2)S/C1=N/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H13IN2O4S/c1-21-16(23)15(9-10-2-7-14(22)13(19)8-10)26-18(21)20-12-5-3-11(4-6-12)17(24)25/h2-9,22H,1H3,(H,24,25)/p-1/b15-9-,20-18+ |
| InChIKey | SUXXDTXZQVOFEY-LBVWADOBSA-M |
| XLogP | 3.30 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|