C25H27NO4 — CID 54680181
3-[(2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one (PubChem CID 54680181) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 3-[(2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one.
| Compound Name | 3-[(2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 54680181 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 3-[(2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
| SMILES | CCC(C)/C=C(C)/C=C/C=C/C=C/C(=O)c1c(O)c(-c2ccc(O)cc2)c[nH]c1=O |
| InChI | InChI=1S/C25H27NO4/c1-4-17(2)15-18(3)9-7-5-6-8-10-22(28)23-24(29)21(16-26-25(23)30)19-11-13-20(27)14-12-19/h5-17,27H,4H2,1-3H3,(H2,26,29,30)/b6-5+,9-7+,10-8+,18-15+ |
| InChIKey | WCQOVQCOVLYQSA-PDOAJKQXSA-N |
| XLogP | 5.30 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|