About [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene
[(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene (PubChem CID 5468033) has the molecular formula C16H14O4S2
and a molecular weight of 334.42 g/mol. Its IUPAC name is [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene.
Molecular Properties
| Compound Name | [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene |
| PubChem CID | 5468033 |
| Molecular Formula | C16H14O4S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene |
| SMILES | O=S(=O)(/C=C/C=C/S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14O4S2/c17-21(18,15-9-3-1-4-10-15)13-7-8-14-22(19,20)16-11-5-2-6-12-16/h1-14H/b13-7+,14-8+ |
| InChIKey | DEXCOBKOWPYHFL-FNCQTZNRSA-N |
| XLogP | 2.96 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene?
The IUPAC name of [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene (CID 5468033) is [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene.
What is the SMILES notation for [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene?
The canonical SMILES for [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene is O=S(=O)(/C=C/C=C/S(=O)(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene?
The InChIKey is DEXCOBKOWPYHFL-FNCQTZNRSA-N. The full InChI is InChI=1S/C16H14O4S2/c17-21(18,15-9-3-1-4-10-15)13-7-8-14-22(19,20)16-11-5-2-6-12-16/h1-14H/b13-7+,14-8+.
What are the key properties of [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene?
[(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene has a molecular weight of 334.42 g/mol, XLogP of 2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E,3E)-4-(benzenesulfonyl)buta-1,3-dienyl]sulfonylbenzene is sourced from PubChem (CID 5468033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).