About ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate
ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate (PubChem CID 54680389) has the molecular formula C21H19Cl2NO4
and a molecular weight of 420.29 g/mol. Its IUPAC name is ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate |
| PubChem CID | 54680389 |
| Molecular Formula | C21H19Cl2NO4 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate |
| SMILES | CCOC(=O)C1=C(O)[C@H](Cc2ccccc2)N(Cc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C21H19Cl2NO4/c1-2-28-21(27)18-19(25)17(11-13-6-4-3-5-7-13)24(20(18)26)12-14-8-9-15(22)16(23)10-14/h3-10,17,25H,2,11-12H2,1H3/t17-/m0/s1 |
| InChIKey | MARBWPNOBKFWKE-KRWDZBQOSA-N |
| XLogP | 4.32 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate?
The IUPAC name of ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate (CID 54680389) is ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate.
What is the SMILES notation for ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate?
The canonical SMILES for ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate is CCOC(=O)C1=C(O)[C@H](Cc2ccccc2)N(Cc2ccc(Cl)c(Cl)c2)C1=O.
What is the InChIKey of ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate?
The InChIKey is MARBWPNOBKFWKE-KRWDZBQOSA-N. The full InChI is InChI=1S/C21H19Cl2NO4/c1-2-28-21(27)18-19(25)17(11-13-6-4-3-5-7-13)24(20(18)26)12-14-8-9-15(22)16(23)10-14/h3-10,17,25H,2,11-12H2,1H3/t17-/m0/s1.
What are the key properties of ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate?
ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate has a molecular weight of 420.29 g/mol, XLogP of 4.32, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-5-oxo-2H-pyrrole-4-carboxylate is sourced from PubChem (CID 54680389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).