C21H15NO4 — CID 54680527
4-hydroxy-8-methyl-6,7-diphenylpyrano[3,2-c]pyridine-2,5-dione (PubChem CID 54680527) has the molecular formula C21H15NO4 and a molecular weight of 345.35 g/mol. Its IUPAC name is 4-hydroxy-8-methyl-6,7-diphenylpyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | 4-hydroxy-8-methyl-6,7-diphenylpyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 54680527 |
| Molecular Formula | C21H15NO4 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 4-hydroxy-8-methyl-6,7-diphenylpyrano[3,2-c]pyridine-2,5-dione |
| SMILES | Cc1c(-c2ccccc2)n(-c2ccccc2)c(=O)c2c(O)cc(=O)oc12 |
| InChI | InChI=1S/C21H15NO4/c1-13-19(14-8-4-2-5-9-14)22(15-10-6-3-7-11-15)21(25)18-16(23)12-17(24)26-20(13)18/h2-12,23H,1H3 |
| InChIKey | RQVLKMZKNMGTKM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |