C21H21NO2 — CID 54680629
4-hydroxy-3-(2,4,6-trimethylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (PubChem CID 54680629) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 4-hydroxy-3-(2,4,6-trimethylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one.
| Compound Name | 4-hydroxy-3-(2,4,6-trimethylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
|---|---|
| PubChem CID | 54680629 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 4-hydroxy-3-(2,4,6-trimethylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| SMILES | Cc1cc(C)c(-c2c(O)c3cccc4c3n(c2=O)CCC4)c(C)c1 |
| InChI | InChI=1S/C21H21NO2/c1-12-10-13(2)17(14(3)11-12)18-20(23)16-8-4-6-15-7-5-9-22(19(15)16)21(18)24/h4,6,8,10-11,23H,5,7,9H2,1-3H3 |
| InChIKey | ZYKRRWSKRVMRNJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |