About 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+)
1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+) (PubChem CID 54680668) has the molecular formula C6H4N3W+
and a molecular weight of 301.96 g/mol. Its IUPAC name is 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+).
Molecular Properties
| Compound Name | 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+) |
| PubChem CID | 54680668 |
| Molecular Formula | C6H4N3W+ |
| Molecular Weight | 301.96 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+) |
| SMILES | [W+2].[c-]1ccc2[nH]cnc2n1 |
| InChI | InChI=1S/C6H4N3.W/c1-2-5-6(7-3-1)9-4-8-5;/h1-2,4H,(H,7,8,9);/q-1;+2 |
| InChIKey | YWPQYTAPOBWGKY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.96 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+)?
The IUPAC name of 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+) (CID 54680668) is 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+).
What is the SMILES notation for 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+)?
The canonical SMILES for 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+) is [W+2].[c-]1ccc2[nH]cnc2n1.
What is the InChIKey of 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+)?
The InChIKey is YWPQYTAPOBWGKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N3.W/c1-2-5-6(7-3-1)9-4-8-5;/h1-2,4H,(H,7,8,9);/q-1;+2.
What are the key properties of 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+)?
1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+) has a molecular weight of 301.96 g/mol, XLogP of 0.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydroimidazo[4,5-b]pyridin-5-ide;tungsten(2+) is sourced from PubChem (CID 54680668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).