C26H32N4O9 — CID 54680681
(4S,5S,6R,12aR)-4-(dimethylamino)-9-[[2-(dimethylamino)acetyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54680681) has the molecular formula C26H32N4O9 and a molecular weight of 544.56 g/mol. Its IUPAC name is (4S,5S,6R,12aR)-4-(dimethylamino)-9-[[2-(dimethylamino)acetyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,5S,6R,12aR)-4-(dimethylamino)-9-[[2-(dimethylamino)acetyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54680681 |
| Molecular Formula | C26H32N4O9 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | (4S,5S,6R,12aR)-4-(dimethylamino)-9-[[2-(dimethylamino)acetyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(NC(=O)CN(C)C)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C26H32N4O9/c1-9-10-6-7-11(28-12(31)8-29(2)3)19(32)14(10)20(33)15-13(9)21(34)17-18(30(4)5)22(35)16(25(27)38)24(37)26(17,39)23(15)36/h6-7,9,13,17-18,21,32-34,37,39H,8H2,1-5H3,(H2,27,38)(H,28,31)/t9-,13?,17?,18-,21?,26-/m0/s1 |
| InChIKey | BCZGHPAJPZHGCI-HAFVSMETSA-N |
| XLogP | -1.00 |
| TPSA | 213.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|