C14H19NO7 — CID 54680709
methyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-hydroxymethyl]piperidine-1-carboxylate (PubChem CID 54680709) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is methyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-hydroxymethyl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-hydroxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54680709 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | methyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-hydroxymethyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(C(O)=C2C(=O)OC(C)(C)OC2=O)CC1 |
| InChI | InChI=1S/C14H19NO7/c1-14(2)21-11(17)9(12(18)22-14)10(16)8-4-6-15(7-5-8)13(19)20-3/h8,16H,4-7H2,1-3H3 |
| InChIKey | XIVUJVZQUHOLOM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|