C18H19NO7 — CID 54680725
5-[[ethyl(methyl)amino]methyl]-6-hydroxy-8-methoxy-3,11,13-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraene-4,14-dione (PubChem CID 54680725) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is 5-[[ethyl(methyl)amino]methyl]-6-hydroxy-8-methoxy-3,11,13-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraene-4,14-dione.
| Compound Name | 5-[[ethyl(methyl)amino]methyl]-6-hydroxy-8-methoxy-3,11,13-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraene-4,14-dione |
|---|---|
| PubChem CID | 54680725 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 5-[[ethyl(methyl)amino]methyl]-6-hydroxy-8-methoxy-3,11,13-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraene-4,14-dione |
| SMILES | CCN(C)Cc1c(O)c2c(OC)cc3c(c2oc1=O)C1CC(=O)OC1O3 |
| InChI | InChI=1S/C18H19NO7/c1-4-19(2)7-9-15(21)14-10(23-3)6-11-13(16(14)26-17(9)22)8-5-12(20)25-18(8)24-11/h6,8,18,21H,4-5,7H2,1-3H3 |
| InChIKey | VJGLPQTZHXAKBN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|