C32H34F3N5O9 — CID 54681047
4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54681047) has the molecular formula C32H34F3N5O9 and a molecular weight of 689.64 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54681047 |
| Molecular Formula | C32H34F3N5O9 |
| Molecular Weight | 689.64 g/mol |
| Exact Mass | 689.23 |
| IUPAC Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CNC(=O)Nc2ccc(OC(F)(F)F)cc2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C32H34F3N5O9/c1-39(2)19-11-14(12-37-30(47)38-15-5-7-16(8-6-15)49-32(33,34)35)24(41)21-17(19)9-13-10-18-23(40(3)4)26(43)22(29(36)46)28(45)31(18,48)27(44)20(13)25(21)42/h5-8,11,13,18,23,41-42,45,48H,9-10,12H2,1-4H3,(H2,36,46)(H2,37,38,47) |
| InChIKey | RRPZDZHDIOGHPW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 214.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.64 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|