C29H29F2N3O7 — CID 54681103
9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54681103) has the molecular formula C29H29F2N3O7 and a molecular weight of 569.56 g/mol. Its IUPAC name is 9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54681103 |
| Molecular Formula | C29H29F2N3O7 |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccc(F)cc2F)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H29F2N3O7/c1-33(2)18-10-14(13-6-5-12(30)9-17(13)31)23(35)20-15(18)7-11-8-16-22(34(3)4)25(37)21(28(32)40)27(39)29(16,41)26(38)19(11)24(20)36/h5-6,9-11,16,22,35-36,39,41H,7-8H2,1-4H3,(H2,32,40) |
| InChIKey | YZOMPCMKEGUGNC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|