About [(Z)-2,3-dichloroprop-2-enyl] thiocyanate
[(Z)-2,3-dichloroprop-2-enyl] thiocyanate (PubChem CID 5468115) has the molecular formula C4H3Cl2NS
and a molecular weight of 168.05 g/mol. Its IUPAC name is [(Z)-2,3-dichloroprop-2-enyl] thiocyanate.
Molecular Properties
| Compound Name | [(Z)-2,3-dichloroprop-2-enyl] thiocyanate |
| PubChem CID | 5468115 |
| Molecular Formula | C4H3Cl2NS |
| Molecular Weight | 168.05 g/mol |
| Exact Mass | 166.94 |
| IUPAC Name | [(Z)-2,3-dichloroprop-2-enyl] thiocyanate |
| SMILES | N#CSC/C(Cl)=C/Cl |
| InChI | InChI=1S/C4H3Cl2NS/c5-1-4(6)2-8-3-7/h1H,2H2/b4-1- |
| InChIKey | JCTDRDLCLPFQSF-RJRFIUFISA-N |
| XLogP | 2.52 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.05 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2,3-dichloroprop-2-enyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2,3-dichloroprop-2-enyl] thiocyanate?
The IUPAC name of [(Z)-2,3-dichloroprop-2-enyl] thiocyanate (CID 5468115) is [(Z)-2,3-dichloroprop-2-enyl] thiocyanate.
What is the SMILES notation for [(Z)-2,3-dichloroprop-2-enyl] thiocyanate?
The canonical SMILES for [(Z)-2,3-dichloroprop-2-enyl] thiocyanate is N#CSC/C(Cl)=C/Cl.
What is the InChIKey of [(Z)-2,3-dichloroprop-2-enyl] thiocyanate?
The InChIKey is JCTDRDLCLPFQSF-RJRFIUFISA-N. The full InChI is InChI=1S/C4H3Cl2NS/c5-1-4(6)2-8-3-7/h1H,2H2/b4-1-.
What are the key properties of [(Z)-2,3-dichloroprop-2-enyl] thiocyanate?
[(Z)-2,3-dichloroprop-2-enyl] thiocyanate has a molecular weight of 168.05 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2,3-dichloroprop-2-enyl] thiocyanate is sourced from PubChem (CID 5468115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).