About 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione
4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione (PubChem CID 54681623) has the molecular formula C18H11NO4
and a molecular weight of 305.29 g/mol. Its IUPAC name is 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione.
Molecular Properties
| Compound Name | 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione |
| PubChem CID | 54681623 |
| Molecular Formula | C18H11NO4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione |
| SMILES | O=c1cc(O)c2c(=O)n(-c3ccccc3)c3ccccc3c2o1 |
| InChI | InChI=1S/C18H11NO4/c20-14-10-15(21)23-17-12-8-4-5-9-13(12)19(18(22)16(14)17)11-6-2-1-3-7-11/h1-10,20H |
| InChIKey | JULHLMULLDMMOV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione?
The IUPAC name of 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione (CID 54681623) is 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione.
What is the SMILES notation for 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione?
The canonical SMILES for 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione is O=c1cc(O)c2c(=O)n(-c3ccccc3)c3ccccc3c2o1.
What is the InChIKey of 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione?
The InChIKey is JULHLMULLDMMOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11NO4/c20-14-10-15(21)23-17-12-8-4-5-9-13(12)19(18(22)16(14)17)11-6-2-1-3-7-11/h1-10,20H.
What are the key properties of 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione?
4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione has a molecular weight of 305.29 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-6-phenylpyrano[3,2-c]quinoline-2,5-dione is sourced from PubChem (CID 54681623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).