C17H22O10 — CID 54681656
tetramethyl (1R,5R,6S,9S)-3,5-dihydroxybicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate (PubChem CID 54681656) has the molecular formula C17H22O10 and a molecular weight of 386.35 g/mol. Its IUPAC name is tetramethyl (1R,5R,6S,9S)-3,5-dihydroxybicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate.
| Compound Name | tetramethyl (1R,5R,6S,9S)-3,5-dihydroxybicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate |
|---|---|
| PubChem CID | 54681656 |
| Molecular Formula | C17H22O10 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | tetramethyl (1R,5R,6S,9S)-3,5-dihydroxybicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate |
| SMILES | COC(=O)C1=C(O)C(C(=O)OC)[C@@]2(O)[C@@H](C(=O)OC)CC[C@@H]1[C@@H]2C(=O)OC |
| InChI | InChI=1S/C17H22O10/c1-24-13(19)8-6-5-7-9(14(20)25-2)12(18)11(16(22)27-4)17(8,23)10(7)15(21)26-3/h7-8,10-11,18,23H,5-6H2,1-4H3/t7-,8+,10+,11?,17+/m0/s1 |
| InChIKey | FTIXWUBFTAXERU-XQTSONMXSA-N |
| XLogP | -0.51 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|