C18H24O10 — CID 54681657
tetramethyl (1R,5R,6S,7R,9S)-3,5-dihydroxy-7-methylbicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate (PubChem CID 54681657) has the molecular formula C18H24O10 and a molecular weight of 400.38 g/mol. Its IUPAC name is tetramethyl (1R,5R,6S,7R,9S)-3,5-dihydroxy-7-methylbicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate.
| Compound Name | tetramethyl (1R,5R,6S,7R,9S)-3,5-dihydroxy-7-methylbicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate |
|---|---|
| PubChem CID | 54681657 |
| Molecular Formula | C18H24O10 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | tetramethyl (1R,5R,6S,7R,9S)-3,5-dihydroxy-7-methylbicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate |
| SMILES | COC(=O)C1=C(O)C(C(=O)OC)[C@@]2(O)[C@@H](C(=O)OC)[C@H](C)C[C@@H]1[C@@H]2C(=O)OC |
| InChI | InChI=1S/C18H24O10/c1-7-6-8-9(14(20)25-2)13(19)12(17(23)28-5)18(24,10(7)15(21)26-3)11(8)16(22)27-4/h7-8,10-12,19,24H,6H2,1-5H3/t7-,8+,10-,11-,12?,18-/m1/s1 |
| InChIKey | MRGZUAQTUKEBIR-XIVCSLGUSA-N |
| XLogP | -0.26 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|