C19H26O10 — CID 54681658
tetramethyl (1R,5R,6S,7R,8R,9S)-3,5-dihydroxy-7,8-dimethylbicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate (PubChem CID 54681658) has the molecular formula C19H26O10 and a molecular weight of 414.41 g/mol. Its IUPAC name is tetramethyl (1R,5R,6S,7R,8R,9S)-3,5-dihydroxy-7,8-dimethylbicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate.
| Compound Name | tetramethyl (1R,5R,6S,7R,8R,9S)-3,5-dihydroxy-7,8-dimethylbicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate |
|---|---|
| PubChem CID | 54681658 |
| Molecular Formula | C19H26O10 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | tetramethyl (1R,5R,6S,7R,8R,9S)-3,5-dihydroxy-7,8-dimethylbicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate |
| SMILES | COC(=O)C1=C(O)C(C(=O)OC)[C@@]2(O)[C@@H](C(=O)OC)[C@H](C)[C@@H](C)[C@@H]1[C@@H]2C(=O)OC |
| InChI | InChI=1S/C19H26O10/c1-7-8(2)11(16(22)27-4)19(25)12(17(23)28-5)9(7)10(15(21)26-3)14(20)13(19)18(24)29-6/h7-9,11-13,20,25H,1-6H3/t7-,8-,9+,11-,12-,13?,19-/m1/s1 |
| InChIKey | WTARNIIZXJFCAC-PDAUWYDZSA-N |
| XLogP | -0.01 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|