About [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea
[(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea (PubChem CID 5468238) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea.
Molecular Properties
| Compound Name | [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea |
| PubChem CID | 5468238 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea |
| SMILES | NC(=O)N/N=C1\C2CC3CC(C2)C1C3 |
| InChI | InChI=1S/C10H15N3O/c11-10(14)13-12-9-7-2-5-1-6(4-7)8(9)3-5/h5-8H,1-4H2,(H3,11,13,14)/b12-9+ |
| InChIKey | DXOBGVCNIGRXSG-FMIVXFBMSA-N |
| XLogP | 1.08 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea?
The IUPAC name of [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea (CID 5468238) is [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea.
What is the SMILES notation for [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea?
The canonical SMILES for [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea is NC(=O)N/N=C1\C2CC3CC(C2)C1C3.
What is the InChIKey of [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea?
The InChIKey is DXOBGVCNIGRXSG-FMIVXFBMSA-N. The full InChI is InChI=1S/C10H15N3O/c11-10(14)13-12-9-7-2-5-1-6(4-7)8(9)3-5/h5-8H,1-4H2,(H3,11,13,14)/b12-9+.
What are the key properties of [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea?
[(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea has a molecular weight of 193.25 g/mol, XLogP of 1.08, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-tricyclo[3.3.1.03,7]nonanylideneamino]urea is sourced from PubChem (CID 5468238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).