C26H27NO5 — CID 54682753
4-hydroxy-6-[5-[3-[2-(2-hydroxyphenyl)ethylamino]propyl]-1-benzofuran-2-yl]-3,5-dimethylpyran-2-one (PubChem CID 54682753) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is 4-hydroxy-6-[5-[3-[2-(2-hydroxyphenyl)ethylamino]propyl]-1-benzofuran-2-yl]-3,5-dimethylpyran-2-one.
| Compound Name | 4-hydroxy-6-[5-[3-[2-(2-hydroxyphenyl)ethylamino]propyl]-1-benzofuran-2-yl]-3,5-dimethylpyran-2-one |
|---|---|
| PubChem CID | 54682753 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 4-hydroxy-6-[5-[3-[2-(2-hydroxyphenyl)ethylamino]propyl]-1-benzofuran-2-yl]-3,5-dimethylpyran-2-one |
| SMILES | Cc1c(-c2cc3cc(CCCNCCc4ccccc4O)ccc3o2)oc(=O)c(C)c1O |
| InChI | InChI=1S/C26H27NO5/c1-16-24(29)17(2)26(30)32-25(16)23-15-20-14-18(9-10-22(20)31-23)6-5-12-27-13-11-19-7-3-4-8-21(19)28/h3-4,7-10,14-15,27-29H,5-6,11-13H2,1-2H3 |
| InChIKey | CJOCWQGZQBXZOM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|