About zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate)
zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate) (PubChem CID 54682895) has the molecular formula C46H42O6Zn
and a molecular weight of 756.23 g/mol. Its IUPAC name is zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate).
Molecular Properties
| Compound Name | zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate) |
| PubChem CID | 54682895 |
| Molecular Formula | C46H42O6Zn |
| Molecular Weight | 756.23 g/mol |
| Exact Mass | 754.23 |
| IUPAC Name | zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate) |
| SMILES | CC(c1ccccc1)c1cc(C(=O)O)c([O-])c(C(C)c2ccccc2)c1.CC(c1ccccc1)c1cc(C(=O)O)c([O-])c(C(C)c2ccccc2)c1.[Zn+2] |
| InChI | InChI=1S/2C23H22O3.Zn/c2*1-15(17-9-5-3-6-10-17)19-13-20(22(24)21(14-19)23(25)26)16(2)18-11-7-4-8-12-18;/h2*3-16,24H,1-2H3,(H,25,26);/q;;+2/p-2 |
| InChIKey | XTUPUYCJWKHGSW-UHFFFAOYSA-L |
| XLogP | 9.52 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 756.23 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate)?
The IUPAC name of zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate) (CID 54682895) is zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate).
What is the SMILES notation for zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate)?
The canonical SMILES for zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate) is CC(c1ccccc1)c1cc(C(=O)O)c([O-])c(C(C)c2ccccc2)c1.CC(c1ccccc1)c1cc(C(=O)O)c([O-])c(C(C)c2ccccc2)c1.[Zn+2].
What is the InChIKey of zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate)?
The InChIKey is XTUPUYCJWKHGSW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C23H22O3.Zn/c2*1-15(17-9-5-3-6-10-17)19-13-20(22(24)21(14-19)23(25)26)16(2)18-11-7-4-8-12-18;/h2*3-16,24H,1-2H3,(H,25,26);/q;;+2/p-2.
What are the key properties of zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate)?
zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate) has a molecular weight of 756.23 g/mol, XLogP of 9.52, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(2-carboxy-4,6-bis(1-phenylethyl)phenolate) is sourced from PubChem (CID 54682895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).