C23H21NO3 — CID 54682900
4-hydroxy-7,7-dimethyl-1,3-diphenyl-6,8-dihydroquinoline-2,5-dione (PubChem CID 54682900) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-hydroxy-7,7-dimethyl-1,3-diphenyl-6,8-dihydroquinoline-2,5-dione.
| Compound Name | 4-hydroxy-7,7-dimethyl-1,3-diphenyl-6,8-dihydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 54682900 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-hydroxy-7,7-dimethyl-1,3-diphenyl-6,8-dihydroquinoline-2,5-dione |
| SMILES | CC1(C)CC(=O)c2c(O)c(-c3ccccc3)c(=O)n(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C23H21NO3/c1-23(2)13-17-20(18(25)14-23)21(26)19(15-9-5-3-6-10-15)22(27)24(17)16-11-7-4-8-12-16/h3-12,26H,13-14H2,1-2H3 |
| InChIKey | KRRMSSNFWTWVAT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |