C15H15NO2 — CID 54683261
8-hydroxy-7,10,10-trimethylpyrido[1,2-a]indol-6-one (PubChem CID 54683261) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 8-hydroxy-7,10,10-trimethylpyrido[1,2-a]indol-6-one.
| Compound Name | 8-hydroxy-7,10,10-trimethylpyrido[1,2-a]indol-6-one |
|---|---|
| PubChem CID | 54683261 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 8-hydroxy-7,10,10-trimethylpyrido[1,2-a]indol-6-one |
| SMILES | Cc1c(O)cc2n(c1=O)-c1ccccc1C2(C)C |
| InChI | InChI=1S/C15H15NO2/c1-9-12(17)8-13-15(2,3)10-6-4-5-7-11(10)16(13)14(9)18/h4-8,17H,1-3H3 |
| InChIKey | RIEJCPXMBZAQCR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |