C16H22O3 — CID 54683264
prop-2-enyl 3-hydroxy-5,5-dimethyl-4,6,7,8-tetrahydro-1H-naphthalene-2-carboxylate (PubChem CID 54683264) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is prop-2-enyl 3-hydroxy-5,5-dimethyl-4,6,7,8-tetrahydro-1H-naphthalene-2-carboxylate.
| Compound Name | prop-2-enyl 3-hydroxy-5,5-dimethyl-4,6,7,8-tetrahydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 54683264 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | prop-2-enyl 3-hydroxy-5,5-dimethyl-4,6,7,8-tetrahydro-1H-naphthalene-2-carboxylate |
| SMILES | C=CCOC(=O)C1=C(O)CC2=C(CCCC2(C)C)C1 |
| InChI | InChI=1S/C16H22O3/c1-4-8-19-15(18)12-9-11-6-5-7-16(2,3)13(11)10-14(12)17/h4,17H,1,5-10H2,2-3H3 |
| InChIKey | DMSRULRDLZFIIV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|