C16H12Cl2N2O4 — CID 54683309
2-[(3,4-dichlorophenyl)methyl]-9-hydroxy-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-6-carbaldehyde (PubChem CID 54683309) has the molecular formula C16H12Cl2N2O4 and a molecular weight of 367.19 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl]-9-hydroxy-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-6-carbaldehyde.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl]-9-hydroxy-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-6-carbaldehyde |
|---|---|
| PubChem CID | 54683309 |
| Molecular Formula | C16H12Cl2N2O4 |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl]-9-hydroxy-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-6-carbaldehyde |
| SMILES | O=Cc1cc(=O)c(O)c2n1CCN(Cc1ccc(Cl)c(Cl)c1)C2=O |
| InChI | InChI=1S/C16H12Cl2N2O4/c17-11-2-1-9(5-12(11)18)7-19-3-4-20-10(8-21)6-13(22)15(23)14(20)16(19)24/h1-2,5-6,8,23H,3-4,7H2 |
| InChIKey | CDHWPBYUDIECKB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|