About methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate
methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate (PubChem CID 54683399) has the molecular formula C17H13ClN2O5
and a molecular weight of 360.75 g/mol. Its IUPAC name is methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate |
| PubChem CID | 54683399 |
| Molecular Formula | C17H13ClN2O5 |
| Molecular Weight | 360.75 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate |
| SMILES | COC(=O)c1cn(Cc2cccc(Cl)c2)c(=O)c2c(O)c(=O)ccn12 |
| InChI | InChI=1S/C17H13ClN2O5/c1-25-17(24)12-9-19(8-10-3-2-4-11(18)7-10)16(23)14-15(22)13(21)5-6-20(12)14/h2-7,9,22H,8H2,1H3 |
| InChIKey | FRXSFOGRAAIWCT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.75 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate?
The IUPAC name of methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate (CID 54683399) is methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate.
What is the SMILES notation for methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate?
The canonical SMILES for methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate is COC(=O)c1cn(Cc2cccc(Cl)c2)c(=O)c2c(O)c(=O)ccn12.
What is the InChIKey of methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate?
The InChIKey is FRXSFOGRAAIWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN2O5/c1-25-17(24)12-9-19(8-10-3-2-4-11(18)7-10)16(23)14-15(22)13(21)5-6-20(12)14/h2-7,9,22H,8H2,1H3.
What are the key properties of methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate?
methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate has a molecular weight of 360.75 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-chlorophenyl)methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-4-carboxylate is sourced from PubChem (CID 54683399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).