C12H22N8 — CID 5468369
N-methyl-N-[(Z)-[(2Z)-2-[methyl(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazinylidene]ethylidene]amino]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 5468369) has the molecular formula C12H22N8 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-methyl-N-[(Z)-[(2Z)-2-[methyl(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazinylidene]ethylidene]amino]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-methyl-N-[(Z)-[(2Z)-2-[methyl(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazinylidene]ethylidene]amino]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 5468369 |
| Molecular Formula | C12H22N8 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-methyl-N-[(Z)-[(2Z)-2-[methyl(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazinylidene]ethylidene]amino]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | CN(/N=C\C=N/N(C)C1=NCCCN1)C1=NCCCN1 |
| InChI | InChI=1S/C12H22N8/c1-19(11-13-5-3-6-14-11)17-9-10-18-20(2)12-15-7-4-8-16-12/h9-10H,3-8H2,1-2H3,(H,13,14)(H,15,16)/b17-9-,18-10- |
| InChIKey | VJENDAJDWPDEKL-XFQWXJFMSA-N |
| XLogP | -0.48 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|