C13H9N3O4 — CID 54683793
5-hydroxy-1-phenyl-8H-pyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 54683793) has the molecular formula C13H9N3O4 and a molecular weight of 271.23 g/mol. Its IUPAC name is 5-hydroxy-1-phenyl-8H-pyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-hydroxy-1-phenyl-8H-pyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 54683793 |
| Molecular Formula | C13H9N3O4 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 5-hydroxy-1-phenyl-8H-pyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | O=c1cc(O)c2c(=O)[nH]c(=O)n(-c3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C13H9N3O4/c17-8-6-9(18)14-11-10(8)12(19)15-13(20)16(11)7-4-2-1-3-5-7/h1-6H,(H2,14,17,18)(H,15,19,20) |
| InChIKey | UJWCMWRYXISZAE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |