About 3-hydroxy-2H-furan-5-one
3-hydroxy-2H-furan-5-one (PubChem CID 54683813) has the molecular formula C4H4O3
and a molecular weight of 100.07 g/mol. Its IUPAC name is 3-hydroxy-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-hydroxy-2H-furan-5-one |
| PubChem CID | 54683813 |
| Molecular Formula | C4H4O3 |
| Molecular Weight | 100.07 g/mol |
| Exact Mass | 100.02 |
| IUPAC Name | 3-hydroxy-2H-furan-5-one |
| SMILES | O=C1C=C(O)CO1 |
| InChI | InChI=1S/C4H4O3/c5-3-1-4(6)7-2-3/h1,5H,2H2 |
| InChIKey | JZQBAGOECGRTSA-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.07 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2H-furan-5-one?
The IUPAC name of 3-hydroxy-2H-furan-5-one (CID 54683813) is 3-hydroxy-2H-furan-5-one.
What is the SMILES notation for 3-hydroxy-2H-furan-5-one?
The canonical SMILES for 3-hydroxy-2H-furan-5-one is O=C1C=C(O)CO1.
What is the InChIKey of 3-hydroxy-2H-furan-5-one?
The InChIKey is JZQBAGOECGRTSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O3/c5-3-1-4(6)7-2-3/h1,5H,2H2.
What are the key properties of 3-hydroxy-2H-furan-5-one?
3-hydroxy-2H-furan-5-one has a molecular weight of 100.07 g/mol, XLogP of -0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2H-furan-5-one is sourced from PubChem (CID 54683813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).