C30H33N3O9 — CID 54684151
tert-butyl 2-[(6aR,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]pyrrole-1-carboxylate (PubChem CID 54684151) has the molecular formula C30H33N3O9 and a molecular weight of 579.61 g/mol. Its IUPAC name is tert-butyl 2-[(6aR,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[(6aR,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 54684151 |
| Molecular Formula | C30H33N3O9 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | tert-butyl 2-[(6aR,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]pyrrole-1-carboxylate |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cccn5C(=O)OC(C)(C)C)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C30H33N3O9/c1-29(2,3)42-28(40)33-10-6-7-17(33)14-8-9-18(34)20-15(14)11-13-12-16-22(32(4)5)24(36)21(27(31)39)26(38)30(16,41)25(37)19(13)23(20)35/h6-10,13,16,22,34-35,38,41H,11-12H2,1-5H3,(H2,31,39)/t13-,16-,22-,30-/m0/s1 |
| InChIKey | ZSWWTQPQKICYDC-RSOPFNNPSA-N |
| XLogP | 2.22 |
| TPSA | 192.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|