C25H33FN6O5 — CID 54684177
N'-[2-[(4-fluorophenyl)methylcarbamoyl]-3-hydroxy-8-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepin-10-yl]-N,N-dimethyl-N'-(2-methylpropyl)oxamide (PubChem CID 54684177) has the molecular formula C25H33FN6O5 and a molecular weight of 516.57 g/mol. Its IUPAC name is N'-[2-[(4-fluorophenyl)methylcarbamoyl]-3-hydroxy-8-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepin-10-yl]-N,N-dimethyl-N'-(2-methylpropyl)oxamide.
| Compound Name | N'-[2-[(4-fluorophenyl)methylcarbamoyl]-3-hydroxy-8-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepin-10-yl]-N,N-dimethyl-N'-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 54684177 |
| Molecular Formula | C25H33FN6O5 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | N'-[2-[(4-fluorophenyl)methylcarbamoyl]-3-hydroxy-8-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepin-10-yl]-N,N-dimethyl-N'-(2-methylpropyl)oxamide |
| SMILES | CC(C)CN(C(=O)C(=O)N(C)C)C1CN(C)CCn2c1nc(C(=O)NCc1ccc(F)cc1)c(O)c2=O |
| InChI | InChI=1S/C25H33FN6O5/c1-15(2)13-32(25(37)24(36)29(3)4)18-14-30(5)10-11-31-21(18)28-19(20(33)23(31)35)22(34)27-12-16-6-8-17(26)9-7-16/h6-9,15,18,33H,10-14H2,1-5H3,(H,27,34) |
| InChIKey | VMZQFTFCNROULD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|