C16H17FN4O5S — CID 54684213
N-[(4-fluorophenyl)methyl]-3-hydroxy-9,9-dimethyl-4,7,7-trioxo-6,8-dihydropyrimido[2,1-d][1,2,5]thiadiazine-2-carboxamide (PubChem CID 54684213) has the molecular formula C16H17FN4O5S and a molecular weight of 396.40 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-hydroxy-9,9-dimethyl-4,7,7-trioxo-6,8-dihydropyrimido[2,1-d][1,2,5]thiadiazine-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-9,9-dimethyl-4,7,7-trioxo-6,8-dihydropyrimido[2,1-d][1,2,5]thiadiazine-2-carboxamide |
|---|---|
| PubChem CID | 54684213 |
| Molecular Formula | C16H17FN4O5S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-9,9-dimethyl-4,7,7-trioxo-6,8-dihydropyrimido[2,1-d][1,2,5]thiadiazine-2-carboxamide |
| SMILES | CC1(C)NS(=O)(=O)Cn2c1nc(C(=O)NCc1ccc(F)cc1)c(O)c2=O |
| InChI | InChI=1S/C16H17FN4O5S/c1-16(2)15-19-11(12(22)14(24)21(15)8-27(25,26)20-16)13(23)18-7-9-3-5-10(17)6-4-9/h3-6,20,22H,7-8H2,1-2H3,(H,18,23) |
| InChIKey | GCUBYHZIHVJKSE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |